![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Биологичес..> | 2023-12-16 23:16 | 37M | |
| Наглядная ..> | 2023-12-16 23:16 | 16M | |
| Biochemistry, 5ed - ..> | 2023-12-16 23:16 | 29M | |
| Chemical Evolution a..> | 2023-12-16 23:16 | 9.3M | |
| Color Atlas of Bioch..> | 2023-12-16 23:16 | 15M | |
| Encyclopedia of Biol..> | 2023-12-16 23:16 | - | |
| Industrial Biotransf..> | 2023-12-16 23:16 | 4.2M | |
| Medicinal Natural Pr..> | 2023-12-16 23:16 | 5.5M | |
| Modern Alkaloids - F..> | 2023-12-16 23:16 | 7.7M | |
| Molecular Neurobiolo..> | 2023-12-16 23:16 | 1.7M | |
| Natural Products The..> | 2023-12-16 23:16 | 39M | |
| Neurochemistry of Co..> | 2023-12-16 23:16 | 3.9M | |
| Phenolic compound bi..> | 2023-12-16 23:16 | 2.5M | |
| Principles of Bioche..> | 2023-12-16 23:16 | 24M | |