![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Comprehensive Medici..> | 2023-12-16 23:16 | 89M | |
| Drug-Membrane Intera..> | 2023-12-16 23:16 | 3.1M | |
| Drugs From Discovery..> | 2023-12-16 23:16 | 6.6M | |
| Exploiting Chemical ..> | 2023-12-16 23:16 | 7.3M | |
| Functional Informati..> | 2023-12-16 23:16 | 4.7M | |
| Fundamentals of Medi..> | 2023-12-16 23:16 | 3.8M | |
| Introduction to Medi..> | 2023-12-16 23:16 | 11M | |
| Medicinal Chemistry,..> | 2023-12-16 23:16 | 35M | |
| Medicinal Chemistry ..> | 2023-12-16 23:16 | 5.3M | |
| Neural Networks in C..> | 2023-12-16 23:16 | 9.2M | |
| New Drug Development..> | 2023-12-16 23:16 | 16M | |
| New Trends in Synthe..> | 2023-12-16 23:16 | 22M | |
| Organic Chemistry of..> | 2023-12-16 23:16 | 2.7M | |
| Pathway Analysis for..> | 2023-12-16 23:16 | 13M | |
| The Art of Drug Synt..> | 2023-12-16 23:16 | 8.3M | |
| The Practice of Medi..> | 2023-12-16 23:16 | 23M | |