![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Compendium of organi..> | 2023-12-16 23:16 | 6.4M | |
| Comprehensive organi..> | 2023-12-16 23:16 | 30M | |
| Handbook of free rad..> | 2023-12-16 23:16 | 24M | |
| Mitsunobu Reaction.pdf | 2023-12-16 23:16 | 36K | |
| Modern organic synth..> | 2023-12-16 23:16 | 4.4M | |
| Organic Syntheses vo..> | 2023-12-16 23:16 | 127M | |
| Organic syntheses - ..> | 2023-12-16 23:16 | 133M | |
| Organikum, 21 ed (de..> | 2023-12-16 23:16 | 16M | |
| Preparation of organ..> | 2023-12-16 23:16 | 3.1M | |
| Purification of Labo..> | 2023-12-16 23:16 | 11M | |
| Safe Use of Chemical..> | 2023-12-16 23:16 | 4.8M | |
| comprehensive organi..> | 2023-12-16 23:16 | 204M | |