![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Computational Chemis..> | 2023-12-16 23:16 | 5.2M | |
| Encyclopedia Of Spec..> | 2023-12-16 23:16 | 62M | |
| Essentials of Comput..> | 2023-12-16 23:16 | 6.9M | |
| Group Theory with Ap..> | 2023-12-16 23:16 | 4.8M | |
| Interpreting Infrare..> | 2023-12-16 23:16 | 29M | |
| Methods for Structur..> | 2023-12-16 23:16 | 15M | |
| NMR Imaging in Chemi..> | 2023-12-16 23:16 | 9.4M | |
| NMR Spectroscopy Exp..> | 2023-12-16 23:16 | 13M | |
| New Techniques in So..> | 2023-12-16 23:16 | 22M | |
| Organic Structures f..> | 2023-12-16 23:16 | 9.3M | |
| Physical Chemistry U..> | 2023-12-16 23:16 | 5.6M | |
| Propellants and Expl..> | 2023-12-16 23:16 | 7.7M | |
| Structure Determinat..> | 2023-12-16 23:16 | 11M | |