![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Colour Chemistry - C..> | 2023-12-16 23:16 | 1.4M | |
| Incendiaries - Advan..> | 2023-12-16 23:16 | 2.3M | |
| Chemistry of Spices.pdf | 2023-12-16 23:16 | 2.9M | |
| Brewing, New technol..> | 2023-12-16 23:16 | 3.3M | |
| Dendrimers in Medici..> | 2023-12-16 23:16 | 5.2M | |
| Chemical Information..> | 2023-12-16 23:16 | 6.1M | |
| Lindsay's Chemical C..> | 2023-12-16 23:16 | 7.2M | |
| Molecular Recognitio..> | 2023-12-16 23:16 | 8.7M | |
| Combinatorial Chemis..> | 2023-12-16 23:16 | 11M | |
| Advances in Flavours..> | 2023-12-16 23:16 | 14M | |
| Wine Chemistry and B..> | 2023-12-16 23:16 | 16M | |
| Phylosophy of Chemis..> | 2023-12-16 23:16 | 16M | |
| Carbon-Reach Compoun..> | 2023-12-16 23:16 | 16M | |
| Chemistry of Fragran..> | 2023-12-16 23:16 | 16M | |
| Chemistry for Pharma..> | 2023-12-16 23:16 | 16M | |
| Star and Hyperbranch..> | 2023-12-16 23:16 | 21M | |